| Product Name | N-bromoacetamide |
| CAS No. | 79-15-2 |
| Synonyms | N-Bromoacetamide; CCRIS 4590; Acetamide, N-bromo- |
| InChI | InChI=1/C2H4BrNO/c1-2(5)4-3/h1H3,(H,4,5) |
| Molecular Formula | C2H4BrNO |
| Molecular Weight | 137.9633 |
| Density | 1.71g/cm3 |
| Refractive index | 1.474 |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
79-15-2 n-bromoacetamide
service@apichina.com