| Product Name | N-Benzylmaleamic acid |
| CAS No. | 15329-69-8 |
| Synonyms | Maleic acid monobenzylamide; 4-(benzylamino)-4-oxobut-2-enoic acid; (2Z)-4-(benzylamino)-4-oxobut-2-enoic acid; (2E)-4-(benzylamino)-4-oxobut-2-enoate |
| InChI | InChI=1/C11H11NO3/c13-10(6-7-11(14)15)12-8-9-4-2-1-3-5-9/h1-7H,8H2,(H,12,13)(H,14,15)/p-1/b7-6+ |
| Molecular Formula | C11H10NO3 |
| Molecular Weight | 204.2025 |
| Melting point | 136-138℃ |
| Boiling point | 476.3°C at 760 mmHg |
| Flash point | 241.9°C |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
15329-69-8 n-benzylmaleamic acid
service@apichina.com