| Product Name | N-Benzylaminoacetaldehyde diethyl acetal |
| CAS No. | 61190-10-1 |
| Synonyms | N-Benzyl-N-(2,2-diethoxyethyl)amine; N-benzyl-2,2-diethoxyethanamine; N-benzyl-2,2-diethoxyethanaminium |
| InChI | InChI=1/C13H21NO2/c1-3-15-13(16-4-2)11-14-10-12-8-6-5-7-9-12/h5-9,13-14H,3-4,10-11H2,1-2H3/p+1 |
| Molecular Formula | C13H22NO2 |
| Molecular Weight | 224.3187 |
| Boiling point | 293.4°C at 760 mmHg |
| Flash point | 124.9°C |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
61190-10-1 n-benzylaminoacetaldehyde diethyl acetal
service@apichina.com