| Product Name | N-Benzyl-N-ethylmethylamine |
| CAS No. | 4788-37-8 |
| Synonyms | N-benzyl-N-methylethanamine |
| InChI | InChI=1/C10H15N/c1-3-11(2)9-10-7-5-4-6-8-10/h4-8H,3,9H2,1-2H3 |
| Molecular Formula | C10H15N |
| Molecular Weight | 149.2328 |
| Density | 0.918g/cm3 |
| Boiling point | 187°C at 760 mmHg |
| Flash point | 59.4°C |
| Refractive index | 1.512 |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
4788-37-8 n-benzyl-n-ethylmethylamine
service@apichina.com