| Product Name | N-benzyl-4-nitro-2,1,3-benzoxadiazol-5-amine |
| CAS No. | 306934-83-8 |
| Synonyms | N-benzyl-7-chloro-4-nitro-2,1,3-benzoxadiazol-5-amine |
| InChI | InChI=1/C13H9ClN4O3/c14-9-6-10(15-7-8-4-2-1-3-5-8)13(18(19)20)12-11(9)16-21-17-12/h1-6,15H,7H2 |
| Molecular Formula | C13H9ClN4O3 |
| Molecular Weight | 304.6886 |
| Density | 1.548g/cm3 |
| Melting point | 136℃ |
| Boiling point | 488.6°C at 760 mmHg |
| Flash point | 249.3°C |
| Refractive index | 1.724 |
| Hazard Symbols | |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
306934-83-8 n-benzyl-4-nitro-2,1,3-benzoxadiazol-5-amine
service@apichina.com