| Product Name | N-Benzoylimidazole |
| CAS No. | 10364-94-0 |
| Synonyms | 1-Benzoylimidazole; 1H-Imidazole, 1-benzoyl-; 1H-imidazol-1-yl(phenyl)methanone |
| InChI | InChI=1/C10H8N2O/c13-10(12-7-6-11-8-12)9-4-2-1-3-5-9/h1-8H |
| Molecular Formula | C10H8N2O |
| Molecular Weight | 172.1833 |
| Density | 1.15g/cm3 |
| Boiling point | 336°C at 760 mmHg |
| Flash point | 157°C |
| Refractive index | 1.604 |
| Risk Codes | R36/38:Irritating to eyes and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
10364-94-0 n-benzoylimidazole
service@apichina.com