| Product Name | n-Amyl 2-furyl ketone |
| CAS No. | 14360-50-0 |
| Synonyms | 2-Furyl Pentyl Ketone; 2-Hexanoylfuran; n-Amyl 2-furyl ketone~2-Furyl n-pentyl ketone; 1-(furan-2-yl)hexan-1-one; 1-furan-2-ylhexan-2-one |
| InChI | InChI=1/C10H14O2/c1-2-3-5-9(11)8-10-6-4-7-12-10/h4,6-7H,2-3,5,8H2,1H3 |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.217 |
| Density | 0.988g/cm3 |
| Boiling point | 228.3°C at 760 mmHg |
| Flash point | 97.4°C |
| Refractive index | 1.466 |
| Safety | S24/25:Avoid contact with skin and eyes.; |
14360-50-0 n-amyl 2-furyl ketone
service@apichina.com