| Product Name | N-Allylrhodanine |
| CAS No. | 1457-47-2 |
| InChI | InChI=1/C6H7NOS2/c1-2-3-7-5(8)4-10-6(7)9/h2H,1,3-4H2 |
| Molecular Formula | C6H7NOS2 |
| Molecular Weight | 173.2559 |
| Density | 1.35g/cm3 |
| Melting point | 43-46℃ |
| Boiling point | 248.8°C at 760 mmHg |
| Flash point | 104.3°C |
| Refractive index | 1.651 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S24/25:Avoid contact with skin and eyes.; |
1457-47-2 n-allylrhodanine
service@apichina.com