| Product Name | N-Acryloylsarcosine methyl ester |
| CAS No. | 72065-23-7 |
| Synonyms | methyl N-acryloyl-N-methylglycinate |
| InChI | InChI=1/C7H11NO3/c1-4-6(9)8(2)5-7(10)11-3/h4H,1,5H2,2-3H3 |
| Molecular Formula | C7H11NO3 |
| Molecular Weight | 157.1671 |
| Density | 1.068g/cm3 |
| Boiling point | 276.3°C at 760 mmHg |
| Flash point | 120.9°C |
| Refractive index | 1.452 |
| Risk Codes | R36/38:Irritating to eyes and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
72065-23-7 n-acryloylsarcosine methyl ester
service@apichina.com