| Product Name | N-Acetylthiourea |
| CAS No. | 591-08-2 |
| Synonyms | N-Acetylthiourea,98%; N-carbamothioylacetamide |
| InChI | InChI=1/C3H6N2OS/c1-2(6)5-3(4)7/h1H3,(H3,4,5,6,7) |
| Molecular Formula | C3H6N2OS |
| Molecular Weight | 118.1575 |
| Density | 1.275g/cm3 |
| Melting point | 166-168℃ |
| Boiling point | 208.6°C at 760 mmHg |
| Flash point | 80°C |
| Refractive index | 1.569 |
| Hazard Symbols |  T:Toxic; |
| Risk Codes | R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.; |
| Safety | S23:Do not inhale gas/fumes/vapour/spray.; S24/25:Avoid contact with skin and eyes.; |
591-08-2 n-acetylthiourea
service@apichina.com