| Product Name | N-(6-Bromohexyl)phthalimide |
| CAS No. | 24566-79-8 |
| Synonyms | 6-(N-Phthalimido)hexyl bromide; 2-(6-bromohexyl)-1H-isoindole-1,3(2H)-dione |
| InChI | InChI=1/C14H16BrNO2/c15-9-5-1-2-6-10-16-13(17)11-7-3-4-8-12(11)14(16)18/h3-4,7-8H,1-2,5-6,9-10H2 |
| Molecular Formula | C14H16BrNO2 |
| Molecular Weight | 310.1863 |
| Density | 1.414g/cm3 |
| Boiling point | 405.2°C at 760 mmHg |
| Flash point | 198.9°C |
| Refractive index | 1.582 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
24566-79-8 n-(6-bromohexyl)phthalimide
service@apichina.com