| Product Name | N-[5-(Trifluoromethyl)pyrid-2-yl]-N-methyl hydrazine |
| CAS No. | 163620-24-4 |
| Synonyms | Trifluoromethylpyridylmethylhydrazine2; 1-Methyl-1-[5-(trifluoromethyl)-2-pyridyl]hydrazine; N-(7-chloroquinolin-4-yl)ethane-1,2-diamine; 1-(5-(trifluoromethyl)pyridin-2-yl)hydrazine |
| InChI | InChI=1/C11H12ClN3/c12-8-1-2-9-10(15-6-4-13)3-5-14-11(9)7-8/h1-3,5,7H,4,6,13H2,(H,14,15) |
| Molecular Formula | C11H12ClN3 |
| Molecular Weight | 221.6861 |
| Density | 1.316g/cm3 |
| Melting point | 52-55℃ |
| Boiling point | 415°C at 760 mmHg |
| Flash point | 204.8°C |
| Refractive index | 1.697 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S36/37:Wear suitable protective clothing and gloves.; |
163620-24-4 n-[5-(trifluoromethyl)pyrid-2-yl]-n-methyl hydrazine
service@apichina.com