| Product Name | N-(5-Bromopentyl)phthalimide |
| CAS No. | 954-81-4 |
| Synonyms | 2-(5-bromopentyl)-1H-isoindole-1,3(2H)-dione |
| InChI | InChI=1/C13H14BrNO2/c14-8-4-1-5-9-15-12(16)10-6-2-3-7-11(10)13(15)17/h2-3,6-7H,1,4-5,8-9H2 |
| Molecular Formula | C13H14BrNO2 |
| Molecular Weight | 296.1598 |
| Density | 1.459g/cm3 |
| Boiling point | 393.1°C at 760 mmHg |
| Flash point | 191.5°C |
| Refractive index | 1.591 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
954-81-4 n-(5-bromopentyl)phthalimide
service@apichina.com