| Product Name | N-(5-bromo-4-methyl-1,3-thiazol-2-yl)guanidine |
| CAS No. | 175136-87-5 |
| Synonyms | 2-(5-bromo-4-methyl-1,3-thiazol-2-yl)guanidine |
| InChI | InChI=1/C5H7BrN4S/c1-2-3(6)11-5(9-2)10-4(7)8/h1H3,(H4,7,8,9,10) |
| Molecular Formula | C5H7BrN4S |
| Molecular Weight | 235.1049 |
| Density | 2.06g/cm3 |
| Melting point | 203℃ |
| Boiling point | 402°C at 760 mmHg |
| Flash point | 196.9°C |
| Refractive index | 1.79 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
175136-87-5 n-(5-bromo-4-methyl-1,3-thiazol-2-yl)guanidine
service@apichina.com