| Product Name | N-(4-propylphenyl)thiourea |
| CAS No. | 175205-18-2 |
| Synonyms | 1-(4-propylphenyl)thiourea |
| InChI | InChI=1/C10H14N2S/c1-2-3-8-4-6-9(7-5-8)12-10(11)13/h4-7H,2-3H2,1H3,(H3,11,12,13) |
| Molecular Formula | C10H14N2S |
| Molecular Weight | 194.2966 |
| Density | 1.164g/cm3 |
| Melting point | 165℃ |
| Boiling point | 310°C at 760 mmHg |
| Flash point | 141.3°C |
| Refractive index | 1.65 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S37/39:Wear suitable gloves and eye/face protection.; |
175205-18-2 n-(4-propylphenyl)thiourea
service@apichina.com