| Product Name | N-(4-Methoxyphenyl)maleamic acid |
| CAS No. | 24870-10-8 |
| Synonyms | Maleic acid mono(4-methoxyphenyl)amide; (2E)-4-[(4-methoxyphenyl)amino]-4-oxobut-2-enoic acid; (2Z)-4-[(4-methoxyphenyl)amino]-4-oxobut-2-enoic acid |
| InChI | InChI=1/C11H11NO4/c1-16-9-4-2-8(3-5-9)12-10(13)6-7-11(14)15/h2-7H,1H3,(H,12,13)(H,14,15)/b7-6- |
| Molecular Formula | C11H11NO4 |
| Molecular Weight | 221.2093 |
| Density | 1.318g/cm3 |
| Boiling point | 473°C at 760 mmHg |
| Flash point | 239.9°C |
| Refractive index | 1.609 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
24870-10-8 n-(4-methoxyphenyl)maleamic acid
service@apichina.com