| Product Name | N-(4-Methoxybenzylidene)aniline |
| CAS No. | 836-41-9 |
| Synonyms | p-Anisaldehyde anil~N-(4-Methoxybenzal)aniline; N-[(E)-(4-methoxyphenyl)methylidene]aniline |
| InChI | InChI=1/C14H13NO/c1-16-14-9-7-12(8-10-14)11-15-13-5-3-2-4-6-13/h2-11H,1H3 |
| Molecular Formula | C14H13NO |
| Molecular Weight | 211.2591 |
| Density | 1g/cm3 |
| Boiling point | 339.002°C at 760 mmHg |
| Flash point | 129.557°C |
| Refractive index | 1.539 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
836-41-9 n-(4-methoxybenzylidene)aniline
service@apichina.com