| Product Name | N-(4-Methoxybenzylidene)-4-butylaniline |
| CAS No. | 26227-73-6 |
| Synonyms | 4-Butyl-N-(4-methoxybenzylidene)aniline; 4-butyl-N-[(E)-(4-methoxyphenyl)methylidene]aniline; Mbba |
| InChI | InChI=1/C18H21NO/c1-3-4-5-15-6-10-17(11-7-15)19-14-16-8-12-18(20-2)13-9-16/h6-14H,3-5H2,1-2H3/b19-14+ |
| Molecular Formula | C18H21NO |
| Molecular Weight | 267.3654 |
| Density | 0.97g/cm3 |
| Boiling point | 403.9°C at 760 mmHg |
| Flash point | 160°C |
| Refractive index | 1.526 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
26227-73-6 n-(4-methoxybenzylidene)-4-butylaniline
service@apichina.com