| Product Name | N-(4-Hydroxyphenyl)glycine |
| CAS No. | 122-87-2 |
| Synonyms | Glycin; 4-hydroxyanilinoacetic acid; [(4-hydroxyphenyl)amino]acetate |
| InChI | InChI=1/C8H9NO3/c10-7-3-1-6(2-4-7)9-5-8(11)12/h1-4,9-10H,5H2,(H,11,12)/p-1 |
| Molecular Formula | C8H8NO3 |
| Molecular Weight | 166.1546 |
| Melting point | 248℃ |
| Boiling point | 446.3°C at 760 mmHg |
| Flash point | 223.7°C |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S24/25:Avoid contact with skin and eyes.; |
122-87-2 n-(4-hydroxyphenyl)glycine
service@apichina.com