| Product Name | N-(4-Fluorobenzylidene)aniline |
| CAS No. | 5676-81-3 |
| InChI | InChI=1/C13H10FN/c14-12-8-6-11(7-9-12)10-15-13-4-2-1-3-5-13/h1-10H |
| Molecular Formula | C13H10FN |
| Molecular Weight | 199.2236 |
| Density | 1.035g/cm3 |
| Melting point | 40℃ |
| Boiling point | 296.169°C at 760 mmHg |
| Flash point | 132.919°C |
| Refractive index | 1.539 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S36/37:Wear suitable protective clothing and gloves.; |
5676-81-3 n-(4-fluorobenzylidene)aniline
service@apichina.com