| Product Name | N-(4-Ethylphenyl)maleimide |
| CAS No. | 76620-00-3 |
| Synonyms | 1-(4-Ethylphenyl)-1H-pyrrole-2,5-dione |
| InChI | InChI=1/C12H11NO2/c1-2-9-3-5-10(6-4-9)13-11(14)7-8-12(13)15/h3-8H,2H2,1H3 |
| Molecular Formula | C12H11NO2 |
| Molecular Weight | 201.2212 |
| Density | 1.233g/cm3 |
| Boiling point | 342.3°C at 760 mmHg |
| Flash point | 154.6°C |
| Refractive index | 1.601 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S22:Do not inhale dust.; S36/37:Wear suitable protective clothing and gloves.; |
76620-00-3 n-(4-ethylphenyl)maleimide
service@apichina.com