| Product Name | N-(4-dimethylamino-3,5-dinitrophenyl)-maleimide, |
| CAS No. | 3475-74-9 |
| Synonyms | N-(4-Dimethylamino-3,5-dinitrophenyl)maleimide; DDPM~Tuppys Maleimide; 1-[4-(dimethylamino)-3,5-dinitrophenyl]-1H-pyrrole-2,5-dione |
| InChI | InChI=1/C12H10N4O6/c1-13(2)12-8(15(19)20)5-7(6-9(12)16(21)22)14-10(17)3-4-11(14)18/h3-6H,1-2H3 |
| Molecular Formula | C12H10N4O6 |
| Molecular Weight | 306.231 |
| Density | 1.595g/cm3 |
| Melting point | 177-181℃ |
| Boiling point | 510.1°C at 760 mmHg |
| Flash point | 262.3°C |
| Refractive index | 1.694 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
3475-74-9 n-(4-dimethylamino-3,5-dinitrophenyl)-maleimide,
service@apichina.com