| Product Name | N-(4-Chloro-2-butynyl)phthalimide |
| CAS No. | 4819-69-6 |
| Synonyms | 1-Chloro-4-(N-phthalimido)-2-butyne; 2-(4-chlorobut-2-yn-1-yl)-1H-isoindole-1,3(2H)-dione |
| InChI | InChI=1/C12H8ClNO2/c13-7-3-4-8-14-11(15)9-5-1-2-6-10(9)12(14)16/h1-2,5-6H,7-8H2 |
| Molecular Formula | C12H8ClNO2 |
| Molecular Weight | 233.6504 |
| Density | 1.391g/cm3 |
| Boiling point | 389.3°C at 760 mmHg |
| Flash point | 189.2°C |
| Refractive index | 1.621 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
4819-69-6 n-(4-chloro-2-butynyl)phthalimide
service@apichina.com