| Product Name | N-(4-Carboxyphenyl)succinamic acid |
| CAS No. | 5694-37-1 |
| Synonyms | 2-[(3-carboxypropanoyl)amino]benzoic acid; 4-[(3-carboxypropanoyl)amino]benzoic acid |
| InChI | InChI=1/C11H11NO5/c13-9(5-6-10(14)15)12-8-3-1-7(2-4-8)11(16)17/h1-4H,5-6H2,(H,12,13)(H,14,15)(H,16,17) |
| Molecular Formula | C11H11NO5 |
| Molecular Weight | 237.2087 |
| Density | 1.458g/cm3 |
| Boiling point | 583.5°C at 760 mmHg |
| Flash point | 306.7°C |
| Refractive index | 1.635 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
5694-37-1 n-(4-carboxyphenyl)succinamic acid
service@apichina.com