| Product Name | N-(4-Carboxyphenyl)phthalimide |
| CAS No. | 5383-82-4 |
| Synonyms | 4-(1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)benzoic acid; 4-(1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)benzoate |
| InChI | InChI=1/C15H9NO4/c17-13-11-3-1-2-4-12(11)14(18)16(13)10-7-5-9(6-8-10)15(19)20/h1-8H,(H,19,20)/p-1 |
| Molecular Formula | C15H8NO4 |
| Molecular Weight | 266.2289 |
| Boiling point | 519.6°C at 760 mmHg |
| Flash point | 268°C |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
5383-82-4 n-(4-carboxyphenyl)phthalimide
service@apichina.com