| Product Name | N-(4,5-dichloro-2-aminophenyl)Acetamide |
| CAS No. | 5462-30-6 |
| InChI | InChI=1/C8H6Cl2N2O3/c1-4(13)11-7-2-5(9)6(10)3-8(7)12(14)15/h2-3H,1H3,(H,11,13) |
| Molecular Formula | C8H6Cl2N2O3 |
| Molecular Weight | 249.0508 |
| Density | 1.573g/cm3 |
| Melting point | 126℃ |
| Boiling point | 418.4°C at 760 mmHg |
| Flash point | 206.8°C |
| Refractive index | 1.637 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
5462-30-6 n-(4,5-dichloro-2-aminophenyl)acetamide
service@apichina.com