| Product Name | N-(3-Methoxyphenyl)maleamic acid |
| CAS No. | 31460-27-2 |
| Synonyms | Maleic acid mono(3-methoxyphenyl)amide; 4-[(3-methoxyphenyl)amino]-4-oxobut-2-enoic acid |
| InChI | InChI=1/C11H11NO4/c1-16-9-4-2-3-8(7-9)12-10(13)5-6-11(14)15/h2-7H,1H3,(H,12,13)(H,14,15) |
| Molecular Formula | C11H11NO4 |
| Molecular Weight | 221.2093 |
| Density | 1.318g/cm3 |
| Boiling point | 467.8°C at 760 mmHg |
| Flash point | 236.7°C |
| Refractive index | 1.609 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
31460-27-2 n-(3-methoxyphenyl)maleamic acid
service@apichina.com