| Product Name | N-(2-Hydroxyethyl)succinimide |
| CAS No. | 18190-44-8 |
| Synonyms | 1-(2-hydroxyethyl)pyrrolidine-2,5-dione |
| InChI | InChI=1/C6H9NO3/c8-4-3-7-5(9)1-2-6(7)10/h8H,1-4H2 |
| Molecular Formula | C6H9NO3 |
| Molecular Weight | 143.1406 |
| Density | 1.327g/cm3 |
| Melting point | 57-61℃ |
| Boiling point | 351.8°C at 760 mmHg |
| Flash point | 166.6°C |
| Refractive index | 1.526 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
18190-44-8 n-(2-hydroxyethyl)succinimide
service@apichina.com