| Product Name | N-(2-Cyanoethyl)glycine |
| CAS No. | 3088-42-4 |
| Synonyms | N-(2-Cyanoehtyl)glycine |
| InChI | InChI=1/C5H8N2O2/c6-2-1-3-7-4-5(8)9/h7H,1,3-4H2,(H,8,9) |
| Molecular Formula | C5H8N2O2 |
| Molecular Weight | 128.1292 |
| Density | 1.187g/cm3 |
| Melting point | 188-193℃ |
| Boiling point | 343.1°C at 760 mmHg |
| Flash point | 161.3°C |
| Refractive index | 1.473 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21:Harmful by inhalation and in contact with skin.; |
| Safety | S23:Do not inhale gas/fumes/vapour/spray.; |
3088-42-4 n-(2-cyanoethyl)glycine
service@apichina.com