| Product Name | N-(2-Chloroethyl)acetamide |
| CAS No. | 7355-58-0 |
| Synonyms | Acetamide, N-(2-chloroethyl)-; 4-04-00-00449 (Beilstein Handbook Reference); AI3-08685; BRN 1743108; NSC 30247 |
| InChI | InChI=1/C4H8ClNO/c1-4(7)6-3-2-5/h2-3H2,1H3,(H,6,7) |
| Molecular Formula | C4H8ClNO |
| Molecular Weight | 121.5654 |
| Density | 1.086g/cm3 |
| Boiling point | 275.6°C at 760 mmHg |
| Flash point | 120.4°C |
| Refractive index | 1.432 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R33:Danger of cummulative effects.; |
| Safety | S24/25:Avoid contact with skin and eyes.; |
7355-58-0 n-(2-chloroethyl)acetamide
service@apichina.com