| Product Name | N-(2-chloroethyl)-1,8-naphthalimide |
| CAS No. | 74732-00-6 |
| Synonyms | 2-(2-chloroethyl)-1H-benzo[de]isoquinoline-1,3(2H)-dione |
| InChI | InChI=1/C14H10ClNO2/c15-7-8-16-13(17)10-5-1-3-9-4-2-6-11(12(9)10)14(16)18/h1-6H,7-8H2 |
| Molecular Formula | C14H10ClNO2 |
| Molecular Weight | 259.6877 |
| Density | 1.398g/cm3 |
| Melting point | 205℃ |
| Boiling point | 433.7°C at 760 mmHg |
| Flash point | 216.1°C |
| Refractive index | 1.673 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
74732-00-6 n-(2-chloroethyl)-1,8-naphthalimide
service@apichina.com