| Product Name | N-(2-Carboxyphenyl)phthalimide |
| CAS No. | 41513-78-4 |
| Synonyms | 2-(1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)benzoic acid |
| InChI | InChI=1/C15H9NO4/c17-13-9-5-1-2-6-10(9)14(18)16(13)12-8-4-3-7-11(12)15(19)20/h1-8H,(H,19,20) |
| Molecular Formula | C15H9NO4 |
| Molecular Weight | 267.2363 |
| Density | 1.49g/cm3 |
| Boiling point | 494.2°C at 760 mmHg |
| Flash point | 252.7°C |
| Refractive index | 1.696 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
41513-78-4 n-(2-carboxyphenyl)phthalimide
service@apichina.com