| Product Name | N-(2,3-dihydro-1,4-benzodioxin-2-ylmethyl)-N-isopropylamine |
| CAS No. | 21398-64-1 |
| Synonyms | N-(2,3-dihydro-1,4-benzodioxin-2-ylmethyl)propan-2-amine |
| InChI | InChI=1/C12H17NO2/c1-9(2)13-7-10-8-14-11-5-3-4-6-12(11)15-10/h3-6,9-10,13H,7-8H2,1-2H3 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.2689 |
| Density | 1.046g/cm3 |
| Boiling point | 288.7°C at 760 mmHg |
| Flash point | 118.1°C |
| Refractive index | 1.509 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
21398-64-1 n-(2,3-dihydro-1,4-benzodioxin-2-ylmethyl)-n-isopropylamine
service@apichina.com