| Product Name | N-(1-Naphthyl)maleamic acid |
| CAS No. | 6973-77-9 |
| Synonyms | N-(1-Naphthyl)maleamic acid; (2Z)-4-(naphthalen-1-ylamino)-4-oxobut-2-enoic acid |
| InChI | InChI=1/C14H11NO3/c16-13(8-9-14(17)18)15-12-7-3-5-10-4-1-2-6-11(10)12/h1-9H,(H,15,16)(H,17,18)/b9-8- |
| Molecular Formula | C14H11NO3 |
| Molecular Weight | 241.242 |
| Density | 1.356g/cm3 |
| Boiling point | 533.9°C at 760 mmHg |
| Flash point | 276.7°C |
| Refractive index | 1.706 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
6973-77-9 n-(1-naphthyl)maleamic acid
service@apichina.com