| Product Name | N-(1,3-benzodioxol-5-ylmethyl)-2-chloroacetamide |
| CAS No. | 40023-03-8 |
| InChI | InChI=1/C10H10ClNO3/c11-4-10(13)12-5-7-1-2-8-9(3-7)15-6-14-8/h1-3H,4-6H2,(H,12,13) |
| Molecular Formula | C10H10ClNO3 |
| Molecular Weight | 227.6443 |
| Density | 1.361g/cm3 |
| Melting point | 91.4℃ |
| Boiling point | 440.5°C at 760 mmHg |
| Flash point | 220.2°C |
| Refractive index | 1.572 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
40023-03-8 n-(1,3-benzodioxol-5-ylmethyl)-2-chloroacetamide
service@apichina.com