| Product Name | myristic acid, monoester with propane-1,2-diol |
| CAS No. | 29059-24-3 |
| Synonyms | Propylene glycol monomyristate; Propylene glycol myristate; Tetradecanoic acid, monoester with 1,2-propanediol; Myristic acid, monoester with propane-1,2-diol; 2-hydroxypropyl tetradecanoate |
| InChI | InChI=1/C17H34O3/c1-3-4-5-6-7-8-9-10-11-12-13-14-17(19)20-15-16(2)18/h16,18H,3-15H2,1-2H3 |
| Molecular Formula | C17H34O3 |
| Molecular Weight | 286.4501 |
| Density | 0.922g/cm3 |
| Boiling point | 392.2°C at 760 mmHg |
| Flash point | 149.1°C |
| Refractive index | 1.453 |
29059-24-3 myristic acid, monoester with propane-1,2-diol
service@apichina.com