| Product Name | Morin |
| CAS No. | 480-16-0 |
| Synonyms | C.I. 75660; C.I. Natural Yellow 8; 2,3,4,5,7-Pentahydroxyflavone; Fustic; Morin dihydrate; 2-(3,5-dihydroxyphenyl)-3,6,8-trihydroxy-4H-chromen-4-one; 2-(2,4-dihydroxyphenyl)-3,5,7-trihydroxy-4H-chromen-4-one |
| InChI | InChI=1/C15H10O7/c16-6-1-2-8(9(18)3-6)15-14(21)13(20)12-10(19)4-7(17)5-11(12)22-15/h1-5,16-19,21H |
| Molecular Formula | C15H10O7 |
| Molecular Weight | 302.2357 |
| Density | 1.799g/cm3 |
| Melting point | 300℃ |
| Boiling point | 645.5°C at 760 mmHg |
| Flash point | 249.3°C |
| Refractive index | 1.823 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
480-16-0 morin
service@apichina.com