| Product Name | mono-methyl sebacate |
| CAS No. | 818-88-2 |
| Synonyms | Monomethyl sebacate~Sebacic acid monomethyl ester; Sebacic acid monomethyl ester; Methyl hydrogen sebacate (Monomethyl sebacate; Sebacic acid monomethyl ester); monomethyl sebacate; 10-methoxy-10-oxodecanoic acid |
| InChI | InChI=1/C11H20O4/c1-15-11(14)9-7-5-3-2-4-6-8-10(12)13/h2-9H2,1H3,(H,12,13) |
| Molecular Formula | C11H20O4 |
| Molecular Weight | 216.2741 |
| Density | 1.038g/cm3 |
| Melting point | 41-44℃ |
| Boiling point | 332.5°C at 760 mmHg |
| Flash point | 115.4°C |
| Refractive index | 1.453 |
| Safety | S24/25:Avoid contact with skin and eyes.; |
818-88-2 mono-methyl sebacate
service@apichina.com