| Product Name | mono-methyl glutarate |
| CAS No. | 1501-27-5 |
| Synonyms | Methyl hydrogen glutarate; Glutaric acid monomethyl ester; Monomethyl glutarate; Pentanedioic acid monomethyl ester; Monoethyl Glutaric Acid; 5-methoxy-5-oxopentanoic acid; 5-methoxy-5-oxopentanoate; 5-{[5-methyl-2-(propan-2-yl)cyclohexyl]oxy}-5-oxopentanoic acid |
| InChI | InChI=1/C15H26O4/c1-10(2)12-8-7-11(3)9-13(12)19-15(18)6-4-5-14(16)17/h10-13H,4-9H2,1-3H3,(H,16,17) |
| Molecular Formula | C15H26O4 |
| Molecular Weight | 270.3645 |
| Density | 1.05g/cm3 |
| Boiling point | 393.406°C at 760 mmHg |
| Flash point | 137.448°C |
| Refractive index | 1.478 |
| Risk Codes | R36/38:Irritating to eyes and skin.; |
| Safety | S23:; S24/25:; |
1501-27-5 mono-methyl glutarate
service@apichina.com