| Product Name | mexenone |
| CAS No. | 1641-17-4 |
| Synonyms | 2-Hydroxy-4-methoxy-4-methylbenzophenone; 2-HYDROXY-4-METHOXY-4'-METHYLBENZOPHENONE; LABOTEST-BB LT00455260; ''MEXENONE''; BENZOPHENONE-10; benzophenone-10,2-hydroxy-4-methoxy-4’-methylbenzophenone; (2-Hydroxy-4-methoxyphenyl)(4-methylphenyl)methanone; HYDROXYMETHOXYMETHYLBENZOPHENONE |
| InChI | InChI=1/C15H14O3/c1-10-3-5-11(6-4-10)15(17)13-8-7-12(18-2)9-14(13)16/h3-9,16H,1-2H3 |
| Molecular Formula | C15H14O3 |
| Molecular Weight | 242.2699 |
| Density | 1.174g/cm3 |
| Boiling point | 400.1°C at 760 mmHg |
| Flash point | 150.2°C |
| Refractive index | 1.588 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
1641-17-4 mexenone
service@apichina.com