| Product Name | (Methylthio)acetic acid |
| CAS No. | 2444-37-3 |
| Synonyms | NSC 263480; (methylsulfanyl)acetic acid |
| InChI | InChI=1/C3H6O2S/c1-6-2-3(4)5/h2H2,1H3,(H,4,5) |
| Molecular Formula | C3H6O2S |
| Molecular Weight | 106.1435 |
| Density | 1.224g/cm3 |
| Melting point | 13-131℃ |
| Boiling point | 225.9°C at 760 mmHg |
| Flash point | 90.4°C |
| Refractive index | 1.5 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
2444-37-3 (methylthio)acetic acid
service@apichina.com