| Product Name | Methylphenylpiperazine |
| CAS No. | 39593-08-3 |
| Synonyms | 1-(4-Methylphenyl)piperazine; N-(p-Tolyl)piperazine; 1-p-tolylpiperazine |
| InChI | InChI=1/C11H16N2/c1-10-2-4-11(5-3-10)13-8-6-12-7-9-13/h2-5,12H,6-9H2,1H3 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.2581 |
| Density | 1.012g/cm3 |
| Boiling point | 321.2°C at 760 mmHg |
| Flash point | 153.8°C |
| Refractive index | 1.54 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
39593-08-3 methylphenylpiperazine
service@apichina.com