| Product Name | Methylnitrobenzaldehyde |
| CAS No. | 31680-07-6 |
| Synonyms | 4-Methyl-3-nitrobenzaldehyde; Benzaldehyde, 4-methyl-3-nitro-; WLN IS WNR B1 EVH [WLN] |
| InChI | InChI=1/C8H7NO3/c1-6-2-3-7(5-10)4-8(6)9(11)12/h2-5H,1H3 |
| Molecular Formula | C8H7NO3 |
| Molecular Weight | 165.1461 |
| Density | 1.278g/cm3 |
| Melting point | 43-54℃ |
| Boiling point | 276.3°C at 760 mmHg |
| Flash point | 130.1°C |
| Refractive index | 1.602 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
31680-07-6 methylnitrobenzaldehyde
service@apichina.com