| Product Name | Methylenebis(3-thiopropionic acid) |
| CAS No. | 4265-57-0 |
| Synonyms | 3,3'-(Methylenebis(thio))bispropionic acid |
| InChI | InChI=1/C7H12O4S2/c8-6(9)4(2-12)1-5(3-13)7(10)11/h4-5,12-13H,1-3H2,(H,8,9)(H,10,11) |
| Molecular Formula | C7H12O4S2 |
| Molecular Weight | 224.2978 |
| Refractive index | 1.571 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
4265-57-0 methylenebis(3-thiopropionic acid)
service@apichina.com