| Product Name | Methyl2-chlorobutyrate, (2-Chlorobutyricacidmethylester) |
| CAS No. | 26464-32-4 |
| Synonyms | Methyl 2-chlorobutyrate; 2-Chlorobutyric acid methyl ester; methyl 2-chlorobutanoate |
| InChI | InChI=1/C5H9ClO2/c1-3-4(6)5(7)8-2/h4H,3H2,1-2H3 |
| Molecular Formula | C5H9ClO2 |
| Molecular Weight | 136.5768 |
| Density | 1.081g/cm3 |
| Boiling point | 149°C at 760 mmHg |
| Flash point | 49.5°C |
| Refractive index | 1.417 |
| Risk Codes | R10:Flammable.; R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
26464-32-4 methyl2-chlorobutyrate, (2-chlorobutyricacidmethylester)
service@apichina.com