| Product Name | Methyl vinyl ether/maleic acid copolymer |
| CAS No. | 25153-40-6 |
| Synonyms | Poly(methyl vinyl ether-alt-maleic acid); methoxyethene-(2Z)-but-2-enedioic acid (1:1); poly(methyl vinyl ether/maleic acid)copolymer |
| InChI | InChI=1/C4H4O4.C3H6O/c5-3(6)1-2-4(7)8;1-3-4-2/h1-2H,(H,5,6)(H,7,8);3H,1H2,2H3/b2-1-; |
| Molecular Formula | C7H10O5 |
| Molecular Weight | 174.1513 |
| Boiling point | 355.5°C at 760 mmHg |
| Flash point | 183°C |
| Safety | S24/25:Avoid contact with skin and eyes.; |
25153-40-6 methyl vinyl ether/maleic acid copolymer
service@apichina.com