| Product Name | Methyl trans-2-pentenoate |
| CAS No. | 15790-88-2 |
| Synonyms | methyl (2E)-pent-2-enoate; methyl (2Z)-pent-2-enoate |
| InChI | InChI=1/C6H10O2/c1-3-4-5-6(7)8-2/h4-5H,3H2,1-2H3/b5-4- |
| Molecular Formula | C6H10O2 |
| Molecular Weight | 114.1424 |
| Density | 0.915g/cm3 |
| Boiling point | 124.5°C at 760 mmHg |
| Flash point | 26.9°C |
| Refractive index | 1.421 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S25:Avoid contact with eyes.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
15790-88-2 methyl trans-2-pentenoate
service@apichina.com