| Product Name | Methyl trans-2-hexenoate |
| CAS No. | 13894-63-8 |
| Synonyms | 237-663-2; 2-Hexenoic acid, methyl ester, (E)-; 4U1VO1 & & E Form; Hex-2-enoic acid methyl ester, (E)-; Methyl (2E)-2-hexenoate; Methyl (2E)-hex-2-enoate; Methyl (E)-2-hexenoate |
| InChI | InChI=1/C7H12O2/c1-3-4-5-6-7(8)9-2/h5-6H,3-4H2,1-2H3/b6-5+ |
| Molecular Formula | C7H12O2 |
| Molecular Weight | 128.169 |
| Density | 0.907g/cm3 |
| Boiling point | 149.3°C at 760 mmHg |
| Flash point | 45.4°C |
| Refractive index | 1.427 |
| Risk Codes | R10:Flammable.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
13894-63-8 methyl trans-2-hexenoate
service@apichina.com