| Product Name | methyl thiosalicylate |
| CAS No. | 4892-02-8 |
| Synonyms | Methyl 2-mercaptobenzoate; 2-Mercaptobenzoic acid methyl ester; methyl 2-sulfanylbenzoate; methoxy(6-thioxocyclohexa-2,4-dien-1-ylidene)methanolate |
| InChI | InChI=1/C8H8O2S/c1-10-8(9)6-4-2-3-5-7(6)11/h2-5,9H,1H3/p-1 |
| Molecular Formula | C8H7O2S |
| Molecular Weight | 167.2055 |
| Boiling point | 240°C at 760 mmHg |
| Flash point | 98.9°C |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
4892-02-8 methyl thiosalicylate
service@apichina.com