| Product Name | Methyl stearate |
| CAS No. | 112-61-8 |
| Synonyms | Methyl n-octadecanoate; Stearic acid methyl ester; methyl octadecanoate; Me-ST |
| InChI | InChI=1/C19H38O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(20)21-2/h3-18H2,1-2H3 |
| Molecular Formula | C19H38O2 |
| Molecular Weight | 298.5038 |
| Density | 0.863g/cm3 |
| Melting point | 37-39℃ |
| Boiling point | 355.5°C at 760 mmHg |
| Flash point | 169.3°C |
| Refractive index | 1.444 |
| Safety | S24/25:Avoid contact with skin and eyes.; |
112-61-8 methyl stearate
service@apichina.com